C20H19F3N4O5 — CID 42920163
4-acetyl-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 42920163) has the molecular formula C20H19F3N4O5 and a molecular weight of 452.39 g/mol. Its IUPAC name is 4-acetyl-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-acetyl-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 42920163 |
| Molecular Formula | C20H19F3N4O5 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 4-acetyl-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CC(=O)N1CC(C(=O)NCCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])Oc2ccccc21 |
| InChI | InChI=1S/C20H19F3N4O5/c1-12(28)26-11-18(32-17-5-3-2-4-15(17)26)19(29)25-9-8-24-14-7-6-13(20(21,22)23)10-16(14)27(30)31/h2-7,10,18,24H,8-9,11H2,1H3,(H,25,29) |
| InChIKey | DFAVMSUDRZHJPT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|