C15H22N4O6S — CID 120784786
(2S,5R)-5-(aminomethyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]oxolane-2-carboxamide (PubChem CID 120784786) has the molecular formula C15H22N4O6S and a molecular weight of 386.43 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120784786 |
| Molecular Formula | C15H22N4O6S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]oxolane-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)[C@@H]2CC[C@H](CN)O2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H22N4O6S/c1-26(23,24)11-3-4-12(13(8-11)19(21)22)17-6-7-18-15(20)14-5-2-10(9-16)25-14/h3-4,8,10,14,17H,2,5-7,9,16H2,1H3,(H,18,20)/t10-,14+/m1/s1 |
| InChIKey | RAULZVOGMGMUKL-YGRLFVJLSA-N |
| XLogP | 0.03 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|