C13H19ClN4O2S — CID 125170570
(3R)-N-[3-(4-chloropyrazol-1-yl)propyl]-6,6-dimethyl-5-oxothiomorpholine-3-carboxamide (PubChem CID 125170570) has the molecular formula C13H19ClN4O2S and a molecular weight of 330.84 g/mol. Its IUPAC name is (3R)-N-[3-(4-chloropyrazol-1-yl)propyl]-6,6-dimethyl-5-oxothiomorpholine-3-carboxamide.
| Compound Name | (3R)-N-[3-(4-chloropyrazol-1-yl)propyl]-6,6-dimethyl-5-oxothiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 125170570 |
| Molecular Formula | C13H19ClN4O2S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (3R)-N-[3-(4-chloropyrazol-1-yl)propyl]-6,6-dimethyl-5-oxothiomorpholine-3-carboxamide |
| SMILES | CC1(C)SC[C@@H](C(=O)NCCCn2cc(Cl)cn2)NC1=O |
| InChI | InChI=1S/C13H19ClN4O2S/c1-13(2)12(20)17-10(8-21-13)11(19)15-4-3-5-18-7-9(14)6-16-18/h6-7,10H,3-5,8H2,1-2H3,(H,15,19)(H,17,20)/t10-/m0/s1 |
| InChIKey | HKRCRBJJURSHKN-JTQLQIEISA-N |
| XLogP | 1.05 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|