C15H24ClN5O2 — CID 72892139
3-N-[3-(4-chloropyrazol-1-yl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide (PubChem CID 72892139) has the molecular formula C15H24ClN5O2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 3-N-[3-(4-chloropyrazol-1-yl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[3-(4-chloropyrazol-1-yl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 72892139 |
| Molecular Formula | C15H24ClN5O2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-N-[3-(4-chloropyrazol-1-yl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide |
| SMILES | CN(C)C(=O)N1CCCC(C(=O)NCCCn2cc(Cl)cn2)C1 |
| InChI | InChI=1S/C15H24ClN5O2/c1-19(2)15(23)20-7-3-5-12(10-20)14(22)17-6-4-8-21-11-13(16)9-18-21/h9,11-12H,3-8,10H2,1-2H3,(H,17,22) |
| InChIKey | TWSDLYFCWZCELG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|