C16H27N5O2 — CID 97193249
(3S)-1-N,1-N-dimethyl-3-N-[3-(4-methylpyrazol-1-yl)propyl]piperidine-1,3-dicarboxamide (PubChem CID 97193249) has the molecular formula C16H27N5O2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (3S)-1-N,1-N-dimethyl-3-N-[3-(4-methylpyrazol-1-yl)propyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N,1-N-dimethyl-3-N-[3-(4-methylpyrazol-1-yl)propyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 97193249 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | (3S)-1-N,1-N-dimethyl-3-N-[3-(4-methylpyrazol-1-yl)propyl]piperidine-1,3-dicarboxamide |
| SMILES | Cc1cnn(CCCNC(=O)[C@H]2CCCN(C(=O)N(C)C)C2)c1 |
| InChI | InChI=1S/C16H27N5O2/c1-13-10-18-21(11-13)9-5-7-17-15(22)14-6-4-8-20(12-14)16(23)19(2)3/h10-11,14H,4-9,12H2,1-3H3,(H,17,22)/t14-/m0/s1 |
| InChIKey | DOUCXHSYRBXPTK-AWEZNQCLSA-N |
| XLogP | 1.09 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|