C18H26FN3O2 — CID 74249959
3-N-[3-(4-fluorophenyl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide (PubChem CID 74249959) has the molecular formula C18H26FN3O2 and a molecular weight of 335.42 g/mol. Its IUPAC name is 3-N-[3-(4-fluorophenyl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[3-(4-fluorophenyl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 74249959 |
| Molecular Formula | C18H26FN3O2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 3-N-[3-(4-fluorophenyl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide |
| SMILES | CN(C)C(=O)N1CCCC(C(=O)NCCCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H26FN3O2/c1-21(2)18(24)22-12-4-6-15(13-22)17(23)20-11-3-5-14-7-9-16(19)10-8-14/h7-10,15H,3-6,11-13H2,1-2H3,(H,20,23) |
| InChIKey | XFVHIQZEIRWHOH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|