C19H26FN5O2 — CID 97196027
(3S)-3-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide (PubChem CID 97196027) has the molecular formula C19H26FN5O2 and a molecular weight of 375.45 g/mol. Its IUPAC name is (3S)-3-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 97196027 |
| Molecular Formula | C19H26FN5O2 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (3S)-3-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide |
| SMILES | CN(C)C(=O)N1CCC[C@H](C(=O)NCCCc2nc3ccc(F)cc3[nH]2)C1 |
| InChI | InChI=1S/C19H26FN5O2/c1-24(2)19(27)25-10-4-5-13(12-25)18(26)21-9-3-6-17-22-15-8-7-14(20)11-16(15)23-17/h7-8,11,13H,3-6,9-10,12H2,1-2H3,(H,21,26)(H,22,23)/t13-/m0/s1 |
| InChIKey | RHYZTHLSUNWWBO-ZDUSSCGKSA-N |
| XLogP | 2.14 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|