C18H20FN3O — CID 46972732
(1R,2R,4R)-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 46972732) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is (1R,2R,4R)-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4R)-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 46972732 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (1R,2R,4R)-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(NCCCc1nc2ccc(F)cc2[nH]1)[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C18H20FN3O/c19-13-5-6-15-16(10-13)22-17(21-15)2-1-7-20-18(23)14-9-11-3-4-12(14)8-11/h3-6,10-12,14H,1-2,7-9H2,(H,20,23)(H,21,22)/t11-,12+,14-/m1/s1 |
| InChIKey | JCGPCZMICPADSZ-MBNYWOFBSA-N |
| XLogP | 2.96 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|