C14H15FN6O2 — CID 162625615
N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-1-methyl-5-oxo-4H-1,2,4-triazole-3-carboxamide (PubChem CID 162625615) has the molecular formula C14H15FN6O2 and a molecular weight of 318.31 g/mol. Its IUPAC name is N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-1-methyl-5-oxo-4H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-1-methyl-5-oxo-4H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 162625615 |
| Molecular Formula | C14H15FN6O2 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-1-methyl-5-oxo-4H-1,2,4-triazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCCCc2nc3ccc(F)cc3[nH]2)[nH]c1=O |
| InChI | InChI=1S/C14H15FN6O2/c1-21-14(23)19-12(20-21)13(22)16-6-2-3-11-17-9-5-4-8(15)7-10(9)18-11/h4-5,7H,2-3,6H2,1H3,(H,16,22)(H,17,18)(H,19,20,23) |
| InChIKey | UCRIDXZANVHWJJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|