C17H19FN4O2 — CID 118775456
2-ethyl-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-4-methyl-1,3-oxazole-5-carboxamide (PubChem CID 118775456) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-ethyl-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-4-methyl-1,3-oxazole-5-carboxamide.
| Compound Name | 2-ethyl-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-4-methyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 118775456 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-ethyl-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-4-methyl-1,3-oxazole-5-carboxamide |
| SMILES | CCc1nc(C)c(C(=O)NCCCc2nc3ccc(F)cc3[nH]2)o1 |
| InChI | InChI=1S/C17H19FN4O2/c1-3-15-20-10(2)16(24-15)17(23)19-8-4-5-14-21-12-7-6-11(18)9-13(12)22-14/h6-7,9H,3-5,8H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | VOPFQGAZTTTYAA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|