C19H27FN4O — CID 97205049
(3R)-1-ethyl-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-3-methylpiperidine-3-carboxamide (PubChem CID 97205049) has the molecular formula C19H27FN4O and a molecular weight of 346.45 g/mol. Its IUPAC name is (3R)-1-ethyl-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-3-methylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-ethyl-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-3-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 97205049 |
| Molecular Formula | C19H27FN4O |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (3R)-1-ethyl-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-3-methylpiperidine-3-carboxamide |
| SMILES | CCN1CCC[C@@](C)(C(=O)NCCCc2nc3ccc(F)cc3[nH]2)C1 |
| InChI | InChI=1S/C19H27FN4O/c1-3-24-11-5-9-19(2,13-24)18(25)21-10-4-6-17-22-15-8-7-14(20)12-16(15)23-17/h7-8,12H,3-6,9-11,13H2,1-2H3,(H,21,25)(H,22,23)/t19-/m1/s1 |
| InChIKey | LUZMXFVNBHGPJA-LJQANCHMSA-N |
| XLogP | 2.87 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|