C20H31N3O3 — CID 74240152
3-N-[3-(2-ethoxyphenyl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide (PubChem CID 74240152) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 3-N-[3-(2-ethoxyphenyl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[3-(2-ethoxyphenyl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 74240152 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 3-N-[3-(2-ethoxyphenyl)propyl]-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide |
| SMILES | CCOc1ccccc1CCCNC(=O)C1CCCN(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C20H31N3O3/c1-4-26-18-12-6-5-9-16(18)10-7-13-21-19(24)17-11-8-14-23(15-17)20(25)22(2)3/h5-6,9,12,17H,4,7-8,10-11,13-15H2,1-3H3,(H,21,24) |
| InChIKey | WCUSFSSSPFCVQM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|