C21H35N3O2 — CID 165425374
(3R,6S)-6-(dimethylamino)-N-[3-(2-ethoxyphenyl)propyl]-1-methylazepane-3-carboxamide (PubChem CID 165425374) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is (3R,6S)-6-(dimethylamino)-N-[3-(2-ethoxyphenyl)propyl]-1-methylazepane-3-carboxamide.
| Compound Name | (3R,6S)-6-(dimethylamino)-N-[3-(2-ethoxyphenyl)propyl]-1-methylazepane-3-carboxamide |
|---|---|
| PubChem CID | 165425374 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | (3R,6S)-6-(dimethylamino)-N-[3-(2-ethoxyphenyl)propyl]-1-methylazepane-3-carboxamide |
| SMILES | CCOc1ccccc1CCCNC(=O)[C@@H]1CC[C@H](N(C)C)CN(C)C1 |
| InChI | InChI=1S/C21H35N3O2/c1-5-26-20-11-7-6-9-17(20)10-8-14-22-21(25)18-12-13-19(23(2)3)16-24(4)15-18/h6-7,9,11,18-19H,5,8,10,12-16H2,1-4H3,(H,22,25)/t18-,19+/m1/s1 |
| InChIKey | LTTBHIIXDYSBJF-MOPGFXCFSA-N |
| XLogP | 2.41 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|