C27H34N4O4 — CID 43930981
N-[3-(2-ethoxyphenyl)propyl]-1-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide (PubChem CID 43930981) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is N-[3-(2-ethoxyphenyl)propyl]-1-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide.
| Compound Name | N-[3-(2-ethoxyphenyl)propyl]-1-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43930981 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | N-[3-(2-ethoxyphenyl)propyl]-1-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide |
| SMILES | CCOc1ccccc1CCCNC(=O)C1CCCN(Cc2nc(-c3ccc(OC)cc3)no2)C1 |
| InChI | InChI=1S/C27H34N4O4/c1-3-34-24-11-5-4-8-20(24)9-6-16-28-27(32)22-10-7-17-31(18-22)19-25-29-26(30-35-25)21-12-14-23(33-2)15-13-21/h4-5,8,11-15,22H,3,6-7,9-10,16-19H2,1-2H3,(H,28,32) |
| InChIKey | UQPRMDFKGLSUTN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|