C25H32N4O3S — CID 43935248
N-[3-(2-propoxyphenyl)propyl]-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide (PubChem CID 43935248) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is N-[3-(2-propoxyphenyl)propyl]-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide.
| Compound Name | N-[3-(2-propoxyphenyl)propyl]-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43935248 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | N-[3-(2-propoxyphenyl)propyl]-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
| SMILES | CCCOc1ccccc1CCCNC(=O)C1CCCN(Cc2nc(-c3cccs3)no2)C1 |
| InChI | InChI=1S/C25H32N4O3S/c1-2-15-31-21-11-4-3-8-19(21)9-5-13-26-25(30)20-10-6-14-29(17-20)18-23-27-24(28-32-23)22-12-7-16-33-22/h3-4,7-8,11-12,16,20H,2,5-6,9-10,13-15,17-18H2,1H3,(H,26,30) |
| InChIKey | QVFJHBGPWJBBOR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|