C22H32N4O2S2 — CID 43935234
N-(3-cyclohexylsulfanylpropyl)-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide (PubChem CID 43935234) has the molecular formula C22H32N4O2S2 and a molecular weight of 448.66 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43935234 |
| Molecular Formula | C22H32N4O2S2 |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCSC1CCCCC1)C1CCCN(Cc2nc(-c3cccs3)no2)C1 |
| InChI | InChI=1S/C22H32N4O2S2/c27-22(23-11-6-14-29-18-8-2-1-3-9-18)17-7-4-12-26(15-17)16-20-24-21(25-28-20)19-10-5-13-30-19/h5,10,13,17-18H,1-4,6-9,11-12,14-16H2,(H,23,27) |
| InChIKey | HOZCTUJOZYAXDI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|