C21H24N4O2S2 — CID 43934961
N-(2-phenylsulfanylethyl)-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide (PubChem CID 43934961) has the molecular formula C21H24N4O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-(2-phenylsulfanylethyl)-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(2-phenylsulfanylethyl)-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43934961 |
| Molecular Formula | C21H24N4O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-(2-phenylsulfanylethyl)-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCSc1ccccc1)C1CCCN(Cc2nc(-c3cccs3)no2)C1 |
| InChI | InChI=1S/C21H24N4O2S2/c26-21(22-10-13-28-17-7-2-1-3-8-17)16-6-4-11-25(14-16)15-19-23-20(24-27-19)18-9-5-12-29-18/h1-3,5,7-9,12,16H,4,6,10-11,13-15H2,(H,22,26) |
| InChIKey | DGPWURAGVOVKCB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|