C25H30N4O3 — CID 43929273
N-[3-(3-methoxyphenyl)propyl]-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide (PubChem CID 43929273) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[3-(3-methoxyphenyl)propyl]-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide.
| Compound Name | N-[3-(3-methoxyphenyl)propyl]-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43929273 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[3-(3-methoxyphenyl)propyl]-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
| SMILES | COc1cccc(CCCNC(=O)C2CCCN(Cc3nc(-c4ccccc4)no3)C2)c1 |
| InChI | InChI=1S/C25H30N4O3/c1-31-22-13-5-8-19(16-22)9-6-14-26-25(30)21-12-7-15-29(17-21)18-23-27-24(28-32-23)20-10-3-2-4-11-20/h2-5,8,10-11,13,16,21H,6-7,9,12,14-15,17-18H2,1H3,(H,26,30) |
| InChIKey | AHJCNPNVJAKHAL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|