C26H31ClN4O4 — CID 43934404
1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(3,4-dimethoxyphenyl)propyl]piperidine-3-carboxamide (PubChem CID 43934404) has the molecular formula C26H31ClN4O4 and a molecular weight of 499.01 g/mol. Its IUPAC name is 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(3,4-dimethoxyphenyl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(3,4-dimethoxyphenyl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43934404 |
| Molecular Formula | C26H31ClN4O4 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(3,4-dimethoxyphenyl)propyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)C2CCCN(Cc3nc(-c4cccc(Cl)c4)no3)C2)cc1OC |
| InChI | InChI=1S/C26H31ClN4O4/c1-33-22-11-10-18(14-23(22)34-2)6-4-12-28-26(32)20-8-5-13-31(16-20)17-24-29-25(30-35-24)19-7-3-9-21(27)15-19/h3,7,9-11,14-15,20H,4-6,8,12-13,16-17H2,1-2H3,(H,28,32) |
| InChIKey | MQVUABMJHOCASV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|