C23H29ClN4O2 — CID 43934174
1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide (PubChem CID 43934174) has the molecular formula C23H29ClN4O2 and a molecular weight of 428.96 g/mol. Its IUPAC name is 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43934174 |
| Molecular Formula | C23H29ClN4O2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CCCN(Cc2nc(-c3cccc(Cl)c3)no2)C1 |
| InChI | InChI=1S/C23H29ClN4O2/c24-20-10-4-8-18(14-20)22-26-21(30-27-22)16-28-13-5-9-19(15-28)23(29)25-12-11-17-6-2-1-3-7-17/h4,6,8,10,14,19H,1-3,5,7,9,11-13,15-16H2,(H,25,29) |
| InChIKey | NXETUIDOFUBYDY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|