C27H32Cl2N4O3 — CID 43934765
1-[[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(3-propan-2-yloxyphenyl)propyl]piperidine-3-carboxamide (PubChem CID 43934765) has the molecular formula C27H32Cl2N4O3 and a molecular weight of 531.48 g/mol. Its IUPAC name is 1-[[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(3-propan-2-yloxyphenyl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(3-propan-2-yloxyphenyl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43934765 |
| Molecular Formula | C27H32Cl2N4O3 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 1-[[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(3-propan-2-yloxyphenyl)propyl]piperidine-3-carboxamide |
| SMILES | CC(C)Oc1cccc(CCCNC(=O)C2CCCN(Cc3nc(-c4ccc(Cl)cc4Cl)no3)C2)c1 |
| InChI | InChI=1S/C27H32Cl2N4O3/c1-18(2)35-22-9-3-6-19(14-22)7-4-12-30-27(34)20-8-5-13-33(16-20)17-25-31-26(32-36-25)23-11-10-21(28)15-24(23)29/h3,6,9-11,14-15,18,20H,4-5,7-8,12-13,16-17H2,1-2H3,(H,30,34) |
| InChIKey | IKPBDUKHZZISSF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|