C20H27ClN4O2 — CID 43933796
1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-pentylpiperidine-3-carboxamide (PubChem CID 43933796) has the molecular formula C20H27ClN4O2 and a molecular weight of 390.92 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-pentylpiperidine-3-carboxamide.
| Compound Name | 1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-pentylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 43933796 |
| Molecular Formula | C20H27ClN4O2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-pentylpiperidine-3-carboxamide |
| SMILES | CCCCCNC(=O)C1CCCN(Cc2nc(-c3ccccc3Cl)no2)C1 |
| InChI | InChI=1S/C20H27ClN4O2/c1-2-3-6-11-22-20(26)15-8-7-12-25(13-15)14-18-23-19(24-27-18)16-9-4-5-10-17(16)21/h4-5,9-10,15H,2-3,6-8,11-14H2,1H3,(H,22,26) |
| InChIKey | ZCEQQIJHLDTSIL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|