C23H32ClN5O2 — CID 43933885
1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-piperidin-1-ylpropyl)piperidine-3-carboxamide (PubChem CID 43933885) has the molecular formula C23H32ClN5O2 and a molecular weight of 446.00 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-piperidin-1-ylpropyl)piperidine-3-carboxamide.
| Compound Name | 1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-piperidin-1-ylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43933885 |
| Molecular Formula | C23H32ClN5O2 |
| Molecular Weight | 446.00 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-piperidin-1-ylpropyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)C1CCCN(Cc2nc(-c3ccccc3Cl)no2)C1 |
| InChI | InChI=1S/C23H32ClN5O2/c24-20-10-3-2-9-19(20)22-26-21(31-27-22)17-29-14-6-8-18(16-29)23(30)25-11-7-15-28-12-4-1-5-13-28/h2-3,9-10,18H,1,4-8,11-17H2,(H,25,30) |
| InChIKey | TZFJEKZQVDBPSF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.00 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|