C28H36N4O3 — CID 43929734
1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(4-propan-2-yloxyphenyl)propyl]piperidine-3-carboxamide (PubChem CID 43929734) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is 1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(4-propan-2-yloxyphenyl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(4-propan-2-yloxyphenyl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43929734 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(4-propan-2-yloxyphenyl)propyl]piperidine-3-carboxamide |
| SMILES | Cc1ccccc1-c1noc(CN2CCCC(C(=O)NCCCc3ccc(OC(C)C)cc3)C2)n1 |
| InChI | InChI=1S/C28H36N4O3/c1-20(2)34-24-14-12-22(13-15-24)9-6-16-29-28(33)23-10-7-17-32(18-23)19-26-30-27(31-35-26)25-11-5-4-8-21(25)3/h4-5,8,11-15,20,23H,6-7,9-10,16-19H2,1-3H3,(H,29,33) |
| InChIKey | MHBYYKCKHVYHGR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|