C26H32N4O2 — CID 43929708
1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(3-methylphenyl)propyl]piperidine-3-carboxamide (PubChem CID 43929708) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(3-methylphenyl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(3-methylphenyl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43929708 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(3-methylphenyl)propyl]piperidine-3-carboxamide |
| SMILES | Cc1cccc(CCCNC(=O)C2CCCN(Cc3nc(-c4ccccc4C)no3)C2)c1 |
| InChI | InChI=1S/C26H32N4O2/c1-19-8-5-10-21(16-19)11-6-14-27-26(31)22-12-7-15-30(17-22)18-24-28-25(29-32-24)23-13-4-3-9-20(23)2/h3-5,8-10,13,16,22H,6-7,11-12,14-15,17-18H2,1-2H3,(H,27,31) |
| InChIKey | XILHNZOPCHPCFX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|