C15H24ClN5O2 — CID 165421933
(3R,6S)-1-acetyl-6-amino-N-[3-(4-chloropyrazol-1-yl)propyl]azepane-3-carboxamide (PubChem CID 165421933) has the molecular formula C15H24ClN5O2 and a molecular weight of 341.84 g/mol. Its IUPAC name is (3R,6S)-1-acetyl-6-amino-N-[3-(4-chloropyrazol-1-yl)propyl]azepane-3-carboxamide.
| Compound Name | (3R,6S)-1-acetyl-6-amino-N-[3-(4-chloropyrazol-1-yl)propyl]azepane-3-carboxamide |
|---|---|
| PubChem CID | 165421933 |
| Molecular Formula | C15H24ClN5O2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (3R,6S)-1-acetyl-6-amino-N-[3-(4-chloropyrazol-1-yl)propyl]azepane-3-carboxamide |
| SMILES | CC(=O)N1C[C@@H](N)CC[C@@H](C(=O)NCCCn2cc(Cl)cn2)C1 |
| InChI | InChI=1S/C15H24ClN5O2/c1-11(22)20-8-12(3-4-14(17)10-20)15(23)18-5-2-6-21-9-13(16)7-19-21/h7,9,12,14H,2-6,8,10,17H2,1H3,(H,18,23)/t12-,14+/m1/s1 |
| InChIKey | RCUBESVEZULYOF-OCCSQVGLSA-N |
| XLogP | 0.63 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|