C13H17Cl2N5O — CID 19539616
N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-3-(4-chloropyrazol-1-yl)propanamide (PubChem CID 19539616) has the molecular formula C13H17Cl2N5O and a molecular weight of 330.22 g/mol. Its IUPAC name is N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-3-(4-chloropyrazol-1-yl)propanamide.
| Compound Name | N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-3-(4-chloropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19539616 |
| Molecular Formula | C13H17Cl2N5O |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-3-(4-chloropyrazol-1-yl)propanamide |
| SMILES | Cc1nn(CCCNC(=O)CCn2cc(Cl)cn2)cc1Cl |
| InChI | InChI=1S/C13H17Cl2N5O/c1-10-12(15)9-20(18-10)5-2-4-16-13(21)3-6-19-8-11(14)7-17-19/h7-9H,2-6H2,1H3,(H,16,21) |
| InChIKey | XJCYQDJJWYRKID-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|