C13H22ClN3O — CID 19543945
3-(4-chloro-3-methylpyrazol-1-yl)-N-hexylpropanamide (PubChem CID 19543945) has the molecular formula C13H22ClN3O and a molecular weight of 271.79 g/mol. Its IUPAC name is 3-(4-chloro-3-methylpyrazol-1-yl)-N-hexylpropanamide.
| Compound Name | 3-(4-chloro-3-methylpyrazol-1-yl)-N-hexylpropanamide |
|---|---|
| PubChem CID | 19543945 |
| Molecular Formula | C13H22ClN3O |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 3-(4-chloro-3-methylpyrazol-1-yl)-N-hexylpropanamide |
| SMILES | CCCCCCNC(=O)CCn1cc(Cl)c(C)n1 |
| InChI | InChI=1S/C13H22ClN3O/c1-3-4-5-6-8-15-13(18)7-9-17-10-12(14)11(2)16-17/h10H,3-9H2,1-2H3,(H,15,18) |
| InChIKey | VXPZFHGQWVQBQQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|