methyl 5-oxo-1,4-thiazepane-3-carboxylate

C7H11NO3S — CID 86246843

IUPACmethyl 5-oxo-1,4-thiazepane-3-carboxylate
SMILESCOC(=O)C1CSCCC(=O)N1
InChIInChI=1S/C7H11NO3S/c1-11-7(10)5-4-12-3-2-6(9)8-5/h5H,2-4H2,1H3,(H,8,9)
InChIKeyMPGYYVKKQLBRGB-UHFFFAOYSA-N
MW189.24 g/mol
LogP-0.22
Rot. Bonds1

About methyl 5-oxo-1,4-thiazepane-3-carboxylate

methyl 5-oxo-1,4-thiazepane-3-carboxylate (PubChem CID 86246843) has the molecular formula C7H11NO3S and a molecular weight of 189.24 g/mol. Its IUPAC name is methyl 5-oxo-1,4-thiazepane-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-oxo-1,4-thiazepane-3-carboxylate
PubChem CID86246843
Molecular FormulaC7H11NO3S
Molecular Weight189.24 g/mol
Exact Mass189.05
IUPAC Namemethyl 5-oxo-1,4-thiazepane-3-carboxylate
SMILESCOC(=O)C1CSCCC(=O)N1
InChIInChI=1S/C7H11NO3S/c1-11-7(10)5-4-12-3-2-6(9)8-5/h5H,2-4H2,1H3,(H,8,9)
InChIKeyMPGYYVKKQLBRGB-UHFFFAOYSA-N
XLogP-0.22
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.24
LogP ≤ 5-0.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 5-oxo-1,4-thiazepane-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-oxo-1,4-thiazepane-3-carboxylate?
The IUPAC name of methyl 5-oxo-1,4-thiazepane-3-carboxylate (CID 86246843) is methyl 5-oxo-1,4-thiazepane-3-carboxylate.
What is the SMILES notation for methyl 5-oxo-1,4-thiazepane-3-carboxylate?
The canonical SMILES for methyl 5-oxo-1,4-thiazepane-3-carboxylate is COC(=O)C1CSCCC(=O)N1.
What is the InChIKey of methyl 5-oxo-1,4-thiazepane-3-carboxylate?
The InChIKey is MPGYYVKKQLBRGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3S/c1-11-7(10)5-4-12-3-2-6(9)8-5/h5H,2-4H2,1H3,(H,8,9).
What are the key properties of methyl 5-oxo-1,4-thiazepane-3-carboxylate?
methyl 5-oxo-1,4-thiazepane-3-carboxylate has a molecular weight of 189.24 g/mol, XLogP of -0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-1,4-thiazepane-3-carboxylate is sourced from PubChem (CID 86246843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).