C11H18N2O2S — CID 95986299
(3S)-3-(piperidine-1-carbonyl)-1,4-thiazepan-5-one (PubChem CID 95986299) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is (3S)-3-(piperidine-1-carbonyl)-1,4-thiazepan-5-one.
| Compound Name | (3S)-3-(piperidine-1-carbonyl)-1,4-thiazepan-5-one |
|---|---|
| PubChem CID | 95986299 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (3S)-3-(piperidine-1-carbonyl)-1,4-thiazepan-5-one |
| SMILES | O=C1CCSC[C@H](C(=O)N2CCCCC2)N1 |
| InChI | InChI=1S/C11H18N2O2S/c14-10-4-7-16-8-9(12-10)11(15)13-5-2-1-3-6-13/h9H,1-8H2,(H,12,14)/t9-/m1/s1 |
| InChIKey | ZUYTZGMPCIINOP-SECBINFHSA-N |
| XLogP | 0.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |