C16H19Cl2N3O2S — CID 71798084
3-[4-(2,3-dichlorophenyl)piperazine-1-carbonyl]-1,4-thiazepan-5-one (PubChem CID 71798084) has the molecular formula C16H19Cl2N3O2S and a molecular weight of 388.32 g/mol. Its IUPAC name is 3-[4-(2,3-dichlorophenyl)piperazine-1-carbonyl]-1,4-thiazepan-5-one.
| Compound Name | 3-[4-(2,3-dichlorophenyl)piperazine-1-carbonyl]-1,4-thiazepan-5-one |
|---|---|
| PubChem CID | 71798084 |
| Molecular Formula | C16H19Cl2N3O2S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 3-[4-(2,3-dichlorophenyl)piperazine-1-carbonyl]-1,4-thiazepan-5-one |
| SMILES | O=C1CCSCC(C(=O)N2CCN(c3cccc(Cl)c3Cl)CC2)N1 |
| InChI | InChI=1S/C16H19Cl2N3O2S/c17-11-2-1-3-13(15(11)18)20-5-7-21(8-6-20)16(23)12-10-24-9-4-14(22)19-12/h1-3,12H,4-10H2,(H,19,22) |
| InChIKey | SLESSQYKWOZKSP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |