C15H17Cl2N3O4S — CID 9299449
(5S)-5-[4-(2,6-dichlorophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 9299449) has the molecular formula C15H17Cl2N3O4S and a molecular weight of 406.29 g/mol. Its IUPAC name is (5S)-5-[4-(2,6-dichlorophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[4-(2,6-dichlorophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 9299449 |
| Molecular Formula | C15H17Cl2N3O4S |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | (5S)-5-[4-(2,6-dichlorophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](C(=O)N2CCN(S(=O)(=O)c3c(Cl)cccc3Cl)CC2)N1 |
| InChI | InChI=1S/C15H17Cl2N3O4S/c16-10-2-1-3-11(17)14(10)25(23,24)20-8-6-19(7-9-20)15(22)12-4-5-13(21)18-12/h1-3,12H,4-9H2,(H,18,21)/t12-/m0/s1 |
| InChIKey | KZTNBNKXOUGSPB-LBPRGKRZSA-N |
| XLogP | 1.10 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |