C16H20ClN3O4S — CID 138808945
5-[4-(2-chlorophenyl)sulfonyl-1,4-diazepane-1-carbonyl]pyrrolidin-2-one (PubChem CID 138808945) has the molecular formula C16H20ClN3O4S and a molecular weight of 385.87 g/mol. Its IUPAC name is 5-[4-(2-chlorophenyl)sulfonyl-1,4-diazepane-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 5-[4-(2-chlorophenyl)sulfonyl-1,4-diazepane-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 138808945 |
| Molecular Formula | C16H20ClN3O4S |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 5-[4-(2-chlorophenyl)sulfonyl-1,4-diazepane-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(C(=O)N2CCCN(S(=O)(=O)c3ccccc3Cl)CC2)N1 |
| InChI | InChI=1S/C16H20ClN3O4S/c17-12-4-1-2-5-14(12)25(23,24)20-9-3-8-19(10-11-20)16(22)13-6-7-15(21)18-13/h1-2,4-5,13H,3,6-11H2,(H,18,21) |
| InChIKey | CYSDYZPTZOUFLG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |