C18H24ClN3O3S — CID 119686577
(3-amino-2-bicyclo[2.2.1]heptanyl)-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 119686577) has the molecular formula C18H24ClN3O3S and a molecular weight of 397.93 g/mol. Its IUPAC name is (3-amino-2-bicyclo[2.2.1]heptanyl)-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3-amino-2-bicyclo[2.2.1]heptanyl)-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119686577 |
| Molecular Formula | C18H24ClN3O3S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (3-amino-2-bicyclo[2.2.1]heptanyl)-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | NC1C2CCC(C2)C1C(=O)N1CCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H24ClN3O3S/c19-14-3-1-2-4-15(14)26(24,25)22-9-7-21(8-10-22)18(23)16-12-5-6-13(11-12)17(16)20/h1-4,12-13,16-17H,5-11,20H2 |
| InChIKey | OZXBYVYJZMBUHD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |