C18H27Cl2N3O — CID 119826840
(3-amino-2-bicyclo[2.2.1]heptanyl)-(4-phenylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 119826840) has the molecular formula C18H27Cl2N3O and a molecular weight of 372.34 g/mol. Its IUPAC name is (3-amino-2-bicyclo[2.2.1]heptanyl)-(4-phenylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | (3-amino-2-bicyclo[2.2.1]heptanyl)-(4-phenylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119826840 |
| Molecular Formula | C18H27Cl2N3O |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (3-amino-2-bicyclo[2.2.1]heptanyl)-(4-phenylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NC1C2CCC(C2)C1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H25N3O.2ClH/c19-17-14-7-6-13(12-14)16(17)18(22)21-10-8-20(9-11-21)15-4-2-1-3-5-15;;/h1-5,13-14,16-17H,6-12,19H2;2*1H |
| InChIKey | HNZPQMJTBNNCPS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |