C13H17N3O4S2 — CID 9496421
(5R)-5-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one (PubChem CID 9496421) has the molecular formula C13H17N3O4S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (5R)-5-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | (5R)-5-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 9496421 |
| Molecular Formula | C13H17N3O4S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (5R)-5-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](C(=O)N2CCN(S(=O)(=O)c3cccs3)CC2)N1 |
| InChI | InChI=1S/C13H17N3O4S2/c17-11-4-3-10(14-11)13(18)15-5-7-16(8-6-15)22(19,20)12-2-1-9-21-12/h1-2,9-10H,3-8H2,(H,14,17)/t10-/m1/s1 |
| InChIKey | KIUNUFWXFXLBKP-SNVBAGLBSA-N |
| XLogP | -0.14 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |