C18H24N2O5S2 — CID 27524803
(1S,6R)-3,4-dimethyl-6-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 27524803) has the molecular formula C18H24N2O5S2 and a molecular weight of 412.53 g/mol. Its IUPAC name is (1S,6R)-3,4-dimethyl-6-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-3,4-dimethyl-6-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 27524803 |
| Molecular Formula | C18H24N2O5S2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (1S,6R)-3,4-dimethyl-6-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=C(C)C[C@@H](C(=O)N2CCN(S(=O)(=O)c3cccs3)CC2)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C18H24N2O5S2/c1-12-10-14(15(18(22)23)11-13(12)2)17(21)19-5-7-20(8-6-19)27(24,25)16-4-3-9-26-16/h3-4,9,14-15H,5-8,10-11H2,1-2H3,(H,22,23)/t14-,15+/m1/s1 |
| InChIKey | KALWCNXWNQMLDY-CABCVRRESA-N |
| XLogP | 2.03 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|