C16H20N2O5S2 — CID 27521047
(1R,6S)-6-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 27521047) has the molecular formula C16H20N2O5S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (1R,6S)-6-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6S)-6-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 27521047 |
| Molecular Formula | C16H20N2O5S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | (1R,6S)-6-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC=CC[C@@H]1C(=O)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C16H20N2O5S2/c19-15(12-4-1-2-5-13(12)16(20)21)17-7-9-18(10-8-17)25(22,23)14-6-3-11-24-14/h1-3,6,11-13H,4-5,7-10H2,(H,20,21)/t12-,13+/m0/s1 |
| InChIKey | DCMPFGMLNGZWOL-QWHCGFSZSA-N |
| XLogP | 1.25 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|