C22H30N2O5S — CID 27527252
(1S,6R)-6-[4-(3,4-dimethylphenyl)sulfonylpiperazine-1-carbonyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 27527252) has the molecular formula C22H30N2O5S and a molecular weight of 434.56 g/mol. Its IUPAC name is (1S,6R)-6-[4-(3,4-dimethylphenyl)sulfonylpiperazine-1-carbonyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[4-(3,4-dimethylphenyl)sulfonylpiperazine-1-carbonyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 27527252 |
| Molecular Formula | C22H30N2O5S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (1S,6R)-6-[4-(3,4-dimethylphenyl)sulfonylpiperazine-1-carbonyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=C(C)C[C@@H](C(=O)N2CCN(S(=O)(=O)c3ccc(C)c(C)c3)CC2)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C22H30N2O5S/c1-14-5-6-18(11-15(14)2)30(28,29)24-9-7-23(8-10-24)21(25)19-12-16(3)17(4)13-20(19)22(26)27/h5-6,11,19-20H,7-10,12-13H2,1-4H3,(H,26,27)/t19-,20+/m1/s1 |
| InChIKey | IYVNSIOLSDVAQT-UXHICEINSA-N |
| XLogP | 2.58 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|