C10H15N3O2S3 — CID 7944078
N-methyl-4-thiophen-2-ylsulfonylpiperazine-1-carbothioamide (PubChem CID 7944078) has the molecular formula C10H15N3O2S3 and a molecular weight of 305.45 g/mol. Its IUPAC name is N-methyl-4-thiophen-2-ylsulfonylpiperazine-1-carbothioamide.
| Compound Name | N-methyl-4-thiophen-2-ylsulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 7944078 |
| Molecular Formula | C10H15N3O2S3 |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | N-methyl-4-thiophen-2-ylsulfonylpiperazine-1-carbothioamide |
| SMILES | CNC(=S)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C10H15N3O2S3/c1-11-10(16)12-4-6-13(7-5-12)18(14,15)9-3-2-8-17-9/h2-3,8H,4-7H2,1H3,(H,11,16) |
| InChIKey | SOTNAODGDITNQC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|