C21H21N3O3S3 — CID 2502086
N-(4-phenoxyphenyl)-4-thiophen-2-ylsulfonylpiperazine-1-carbothioamide (PubChem CID 2502086) has the molecular formula C21H21N3O3S3 and a molecular weight of 459.62 g/mol. Its IUPAC name is N-(4-phenoxyphenyl)-4-thiophen-2-ylsulfonylpiperazine-1-carbothioamide.
| Compound Name | N-(4-phenoxyphenyl)-4-thiophen-2-ylsulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2502086 |
| Molecular Formula | C21H21N3O3S3 |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | N-(4-phenoxyphenyl)-4-thiophen-2-ylsulfonylpiperazine-1-carbothioamide |
| SMILES | O=S(=O)(c1cccs1)N1CCN(C(=S)Nc2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C21H21N3O3S3/c25-30(26,20-7-4-16-29-20)24-14-12-23(13-15-24)21(28)22-17-8-10-19(11-9-17)27-18-5-2-1-3-6-18/h1-11,16H,12-15H2,(H,22,28) |
| InChIKey | GTOLZBQSVBPZBZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|