C18H22N2O4S2 — CID 110346389
2-methyl-2-phenoxy-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-1-one (PubChem CID 110346389) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-methyl-2-phenoxy-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-1-one.
| Compound Name | 2-methyl-2-phenoxy-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 110346389 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 2-methyl-2-phenoxy-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-1-one |
| SMILES | CC(C)(Oc1ccccc1)C(=O)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H22N2O4S2/c1-18(2,24-15-7-4-3-5-8-15)17(21)19-10-12-20(13-11-19)26(22,23)16-9-6-14-25-16/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | HDTMQKOOFVDTOC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |