C16H21N3O3S — CID 95986494
(3S)-3-[4-(2-hydroxyphenyl)piperazine-1-carbonyl]-1,4-thiazepan-5-one (PubChem CID 95986494) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is (3S)-3-[4-(2-hydroxyphenyl)piperazine-1-carbonyl]-1,4-thiazepan-5-one.
| Compound Name | (3S)-3-[4-(2-hydroxyphenyl)piperazine-1-carbonyl]-1,4-thiazepan-5-one |
|---|---|
| PubChem CID | 95986494 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (3S)-3-[4-(2-hydroxyphenyl)piperazine-1-carbonyl]-1,4-thiazepan-5-one |
| SMILES | O=C1CCSC[C@H](C(=O)N2CCN(c3ccccc3O)CC2)N1 |
| InChI | InChI=1S/C16H21N3O3S/c20-14-4-2-1-3-13(14)18-6-8-19(9-7-18)16(22)12-11-23-10-5-15(21)17-12/h1-4,12,20H,5-11H2,(H,17,21)/t12-/m1/s1 |
| InChIKey | ADWAIHHRIRIFIB-GFCCVEGCSA-N |
| XLogP | 0.66 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |