C7H12O2S2 — CID 71745910
methyl 1,4-dithiepane-6-carboxylate (PubChem CID 71745910) has the molecular formula C7H12O2S2 and a molecular weight of 192.30 g/mol. Its IUPAC name is methyl 1,4-dithiepane-6-carboxylate.
| Compound Name | methyl 1,4-dithiepane-6-carboxylate |
|---|---|
| PubChem CID | 71745910 |
| Molecular Formula | C7H12O2S2 |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | methyl 1,4-dithiepane-6-carboxylate |
| SMILES | COC(=O)C1CSCCSC1 |
| InChI | InChI=1S/C7H12O2S2/c1-9-7(8)6-4-10-2-3-11-5-6/h6H,2-5H2,1H3 |
| InChIKey | MYLRJXSQSCYCIG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |