C10H15NO3S — CID 54446812
methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate (PubChem CID 54446812) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate.
| Compound Name | methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate |
|---|---|
| PubChem CID | 54446812 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate |
| SMILES | COC(=O)C1CSC=CCCCC(=O)N1 |
| InChI | InChI=1S/C10H15NO3S/c1-14-10(13)8-7-15-6-4-2-3-5-9(12)11-8/h4,6,8H,2-3,5,7H2,1H3,(H,11,12) |
| InChIKey | WSCIRTTXAYVQAD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |