methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate

C10H15NO3S — CID 54446812

IUPACmethyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate
SMILESCOC(=O)C1CSC=CCCCC(=O)N1
InChIInChI=1S/C10H15NO3S/c1-14-10(13)8-7-15-6-4-2-3-5-9(12)11-8/h4,6,8H,2-3,5,7H2,1H3,(H,11,12)
InChIKeyWSCIRTTXAYVQAD-UHFFFAOYSA-N
MW229.30 g/mol
LogP1.08
Rot. Bonds1

About methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate

methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate (PubChem CID 54446812) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate
PubChem CID54446812
Molecular FormulaC10H15NO3S
Molecular Weight229.30 g/mol
Exact Mass229.08
IUPAC Namemethyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate
SMILESCOC(=O)C1CSC=CCCCC(=O)N1
InChIInChI=1S/C10H15NO3S/c1-14-10(13)8-7-15-6-4-2-3-5-9(12)11-8/h4,6,8H,2-3,5,7H2,1H3,(H,11,12)
InChIKeyWSCIRTTXAYVQAD-UHFFFAOYSA-N
XLogP1.08
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.30
LogP ≤ 51.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate?
The IUPAC name of methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate (CID 54446812) is methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate.
What is the SMILES notation for methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate?
The canonical SMILES for methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate is COC(=O)C1CSC=CCCCC(=O)N1.
What is the InChIKey of methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate?
The InChIKey is WSCIRTTXAYVQAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3S/c1-14-10(13)8-7-15-6-4-2-3-5-9(12)11-8/h4,6,8H,2-3,5,7H2,1H3,(H,11,12).
What are the key properties of methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate?
methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate has a molecular weight of 229.30 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylate is sourced from PubChem (CID 54446812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).