C9H13NO3S — CID 20503389
(9Z)-5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylic acid (PubChem CID 20503389) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is (9Z)-5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylic acid.
| Compound Name | (9Z)-5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylic acid |
|---|---|
| PubChem CID | 20503389 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (9Z)-5-oxo-2,3,4,6,7,8-hexahydro-1,4-thiazecine-3-carboxylic acid |
| SMILES | O=C1CCC/C=C\SCC(C(=O)O)N1 |
| InChI | InChI=1S/C9H13NO3S/c11-8-4-2-1-3-5-14-6-7(10-8)9(12)13/h3,5,7H,1-2,4,6H2,(H,10,11)(H,12,13)/b5-3- |
| InChIKey | NRHLMBUXXTXDIO-HYXAFXHYSA-N |
| XLogP | 0.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |