C7H10N2O4S — CID 161449908
5,8-dioxo-1,4,7-thiadiazonane-3-carboxylic acid (PubChem CID 161449908) has the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. Its IUPAC name is 5,8-dioxo-1,4,7-thiadiazonane-3-carboxylic acid.
| Compound Name | 5,8-dioxo-1,4,7-thiadiazonane-3-carboxylic acid |
|---|---|
| PubChem CID | 161449908 |
| Molecular Formula | C7H10N2O4S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 5,8-dioxo-1,4,7-thiadiazonane-3-carboxylic acid |
| SMILES | O=C1CSCC(C(=O)O)NC(=O)CN1 |
| InChI | InChI=1S/C7H10N2O4S/c10-5-1-8-6(11)3-14-2-4(9-5)7(12)13/h4H,1-3H2,(H,8,11)(H,9,10)(H,12,13) |
| InChIKey | AAEPLCOLQJHBFJ-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |