C5H8NO3PS — CID 122584871
(2R,4R)-6-oxo-4-sulfanyl-1,4-azaphosphinane-2-carboxylic acid (PubChem CID 122584871) has the molecular formula C5H8NO3PS and a molecular weight of 193.16 g/mol. Its IUPAC name is (2R,4R)-6-oxo-4-sulfanyl-1,4-azaphosphinane-2-carboxylic acid.
| Compound Name | (2R,4R)-6-oxo-4-sulfanyl-1,4-azaphosphinane-2-carboxylic acid |
|---|---|
| PubChem CID | 122584871 |
| Molecular Formula | C5H8NO3PS |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.00 |
| IUPAC Name | (2R,4R)-6-oxo-4-sulfanyl-1,4-azaphosphinane-2-carboxylic acid |
| SMILES | O=C1C[P@](S)C[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C5H8NO3PS/c7-4-2-10(11)1-3(6-4)5(8)9/h3,11H,1-2H2,(H,6,7)(H,8,9)/t3-,10+/m0/s1 |
| InChIKey | ONSJWPJMIMTXLB-ILMLOSMKSA-N |
| XLogP | -0.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|