About methane;(2S)-4-oxoazetidine-2-carboxylic acid
methane;(2S)-4-oxoazetidine-2-carboxylic acid (PubChem CID 143306499) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is methane;(2S)-4-oxoazetidine-2-carboxylic acid.
Molecular Properties
| Compound Name | methane;(2S)-4-oxoazetidine-2-carboxylic acid |
| PubChem CID | 143306499 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | methane;(2S)-4-oxoazetidine-2-carboxylic acid |
| SMILES | C.O=C1C[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C4H5NO3.CH4/c6-3-1-2(5-3)4(7)8;/h2H,1H2,(H,5,6)(H,7,8);1H4/t2-;/m0./s1 |
| InChIKey | JZJRZMQDTTUJNA-DKWTVANSSA-N |
| XLogP | -0.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;(2S)-4-oxoazetidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(2S)-4-oxoazetidine-2-carboxylic acid?
The IUPAC name of methane;(2S)-4-oxoazetidine-2-carboxylic acid (CID 143306499) is methane;(2S)-4-oxoazetidine-2-carboxylic acid.
What is the SMILES notation for methane;(2S)-4-oxoazetidine-2-carboxylic acid?
The canonical SMILES for methane;(2S)-4-oxoazetidine-2-carboxylic acid is C.O=C1C[C@@H](C(=O)O)N1.
What is the InChIKey of methane;(2S)-4-oxoazetidine-2-carboxylic acid?
The InChIKey is JZJRZMQDTTUJNA-DKWTVANSSA-N. The full InChI is InChI=1S/C4H5NO3.CH4/c6-3-1-2(5-3)4(7)8;/h2H,1H2,(H,5,6)(H,7,8);1H4/t2-;/m0./s1.
What are the key properties of methane;(2S)-4-oxoazetidine-2-carboxylic acid?
methane;(2S)-4-oxoazetidine-2-carboxylic acid has a molecular weight of 131.13 g/mol, XLogP of -0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(2S)-4-oxoazetidine-2-carboxylic acid is sourced from PubChem (CID 143306499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).