methane;(2S)-4-oxoazetidine-2-carboxylic acid

C5H9NO3 — CID 143306499

IUPACmethane;(2S)-4-oxoazetidine-2-carboxylic acid
SMILESC.O=C1C[C@@H](C(=O)O)N1
InChIInChI=1S/C4H5NO3.CH4/c6-3-1-2(5-3)4(7)8;/h2H,1H2,(H,5,6)(H,7,8);1H4/t2-;/m0./s1
InChIKeyJZJRZMQDTTUJNA-DKWTVANSSA-N
MW131.13 g/mol
LogP-0.40
Rot. Bonds1

About methane;(2S)-4-oxoazetidine-2-carboxylic acid

methane;(2S)-4-oxoazetidine-2-carboxylic acid (PubChem CID 143306499) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is methane;(2S)-4-oxoazetidine-2-carboxylic acid.

Molecular Properties

Compound Namemethane;(2S)-4-oxoazetidine-2-carboxylic acid
PubChem CID143306499
Molecular FormulaC5H9NO3
Molecular Weight131.13 g/mol
Exact Mass131.06
IUPAC Namemethane;(2S)-4-oxoazetidine-2-carboxylic acid
SMILESC.O=C1C[C@@H](C(=O)O)N1
InChIInChI=1S/C4H5NO3.CH4/c6-3-1-2(5-3)4(7)8;/h2H,1H2,(H,5,6)(H,7,8);1H4/t2-;/m0./s1
InChIKeyJZJRZMQDTTUJNA-DKWTVANSSA-N
XLogP-0.40
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.13
LogP ≤ 5-0.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze methane;(2S)-4-oxoazetidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methane;(2S)-4-oxoazetidine-2-carboxylic acid?
The IUPAC name of methane;(2S)-4-oxoazetidine-2-carboxylic acid (CID 143306499) is methane;(2S)-4-oxoazetidine-2-carboxylic acid.
What is the SMILES notation for methane;(2S)-4-oxoazetidine-2-carboxylic acid?
The canonical SMILES for methane;(2S)-4-oxoazetidine-2-carboxylic acid is C.O=C1C[C@@H](C(=O)O)N1.
What is the InChIKey of methane;(2S)-4-oxoazetidine-2-carboxylic acid?
The InChIKey is JZJRZMQDTTUJNA-DKWTVANSSA-N. The full InChI is InChI=1S/C4H5NO3.CH4/c6-3-1-2(5-3)4(7)8;/h2H,1H2,(H,5,6)(H,7,8);1H4/t2-;/m0./s1.
What are the key properties of methane;(2S)-4-oxoazetidine-2-carboxylic acid?
methane;(2S)-4-oxoazetidine-2-carboxylic acid has a molecular weight of 131.13 g/mol, XLogP of -0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(2S)-4-oxoazetidine-2-carboxylic acid is sourced from PubChem (CID 143306499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).