About iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid)
iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid) (PubChem CID 90659612) has the molecular formula C10H14FeN2O6
and a molecular weight of 314.08 g/mol. Its IUPAC name is iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid).
Molecular Properties
| Compound Name | iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid) |
| PubChem CID | 90659612 |
| Molecular Formula | C10H14FeN2O6 |
| Molecular Weight | 314.08 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid) |
| SMILES | O=C1CC[C@@H](C(=O)O)N1.O=C1CC[C@@H](C(=O)O)N1.[Fe] |
| InChI | InChI=1S/2C5H7NO3.Fe/c2*7-4-2-1-3(6-4)5(8)9;/h2*3H,1-2H2,(H,6,7)(H,8,9);/t2*3-;/m00./s1 |
| InChIKey | BDEZCLLXWQFLCA-QHTZZOMLSA-N |
| XLogP | -1.30 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.08 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid)?
The IUPAC name of iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid) (CID 90659612) is iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid).
What is the SMILES notation for iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid)?
The canonical SMILES for iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid) is O=C1CC[C@@H](C(=O)O)N1.O=C1CC[C@@H](C(=O)O)N1.[Fe].
What is the InChIKey of iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid)?
The InChIKey is BDEZCLLXWQFLCA-QHTZZOMLSA-N. The full InChI is InChI=1S/2C5H7NO3.Fe/c2*7-4-2-1-3(6-4)5(8)9;/h2*3H,1-2H2,(H,6,7)(H,8,9);/t2*3-;/m00./s1.
What are the key properties of iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid)?
iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid) has a molecular weight of 314.08 g/mol, XLogP of -1.30, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iron;bis((2S)-5-oxopyrrolidine-2-carboxylic acid) is sourced from PubChem (CID 90659612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).